Products 98672-91-4
CAS 98672-91-4 appears in our catalog under these names: SQ-29548, SQ 29,548, SQ 29,548, 98%, 98%, SQ 29548, 99.9%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 1mg, 10mg, 5mg, 1 mg.
(Z)-7-[(1S,2R,3R,4R)-3-[[2-(phenylcarbamoyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (CAS 98672-91-4) is a chemical compound with the molecular formula C21H29N3O4 and a molecular weight of 387.5 g/mol. IUPAC name: (Z)-7-[(1S,2R,3R,4R)-3-[[2-(phenylcarbamoyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid. InChIKey: RJNDVCNWVBWHLY-YVUOLYODSA-N.
| Molecular formula | C21H29N3O4 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | (Z)-7-[(1S,2R,3R,4R)-3-[[2-(phenylcarbamoyl)hydrazinyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| InChIKey | RJNDVCNWVBWHLY-YVUOLYODSA-N |
| SMILES | C1C[C@@H]2[C@H]([C@H]([C@H]1O2)C/C=C\CCCC(=O)O)CNNC(=O)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)