CAS 2854233-44-4 is the registry number for SORT1-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5,5-dimethylhexanoic acid (CAS 2854233-44-4) is a chemical compound with the molecular formula C21H29N3O4 and a molecular weight of 387.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5,5-dimethylhexanoic acid. InChIKey: GSBCZCUNGGVJCP-ROUUACIJSA-N.
| Molecular formula | C21H29N3O4 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-5,5-dimethylhexanoic acid |
| InChIKey | GSBCZCUNGGVJCP-ROUUACIJSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CNC2=CC=CC=C21)C(=O)N[C@@H](CCC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)