Products 2130879-94-4
CAS 2130879-94-4 is the registry number for MAB–CHMINACA metabolite M3. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
(2S)-2-[[1-[(4-hydroxycyclohexyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid (CAS 2130879-94-4) is a chemical compound with the molecular formula C21H29N3O4 and a molecular weight of 387.5 g/mol. IUPAC name: (2S)-2-[[1-[(4-hydroxycyclohexyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid. InChIKey: HWEQMPAYSNTICF-WTNGLUPJSA-N.
| Molecular formula | C21H29N3O4 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | (2S)-2-[[1-[(4-hydroxycyclohexyl)methyl]indazole-3-carbonyl]amino]-3,3-dimethylbutanoic acid |
| InChIKey | HWEQMPAYSNTICF-WTNGLUPJSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3CCC(CC3)O |
Computed by PubChem (NCBI)