CAS 98815-54-4 is the registry number for 4–(Acetyl–d3)–bromobenzene. Offered by: GLPBio. Available pack sizes: 20mg.
1-(4-bromophenyl)-2,2,2-trideuterioethanone (CAS 98815-54-4) is a chemical compound with the molecular formula C8H7BrO and a molecular weight of 202.06 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2,2-trideuterioethanone. InChIKey: WYECURVXVYPVAT-FIBGUPNXSA-N.
| Molecular formula | C8H7BrO |
|---|---|
| Molecular weight | 202.06 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2,2-trideuterioethanone |
| InChIKey | WYECURVXVYPVAT-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)