CAS 98841-72-6 appears in our catalog under these names: 1,2,3,4-Tetrahydronaphthalene-1-carboxamide, Palonosetron Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
1,2,3,4-tetrahydronaphthalene-1-carboxamide (CAS 98841-72-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1,2,3,4-tetrahydronaphthalene-1-carboxamide. InChIKey: YABTYLPBLUXORV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| InChIKey | YABTYLPBLUXORV-UHFFFAOYSA-N |
| SMILES | C1CC(C2=CC=CC=C2C1)C(=O)N |
Computed by PubChem (NCBI)