CAS 98974-89-1 appears in our catalog under these names: 1,2:4,5-Di-O-isopropylidene-D,L-myo-inositol, 1,2:4,5-Bis-O-(1-methylethylidene)-myo-inositol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 50mg, 25mg, 100mg, 250mg, Get quote.
(3S,9S)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol (CAS 98974-89-1) is a chemical compound with the molecular formula C12H20O6 and a molecular weight of 260.28 g/mol. IUPAC name: (3S,9S)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol. InChIKey: LDPFQVWIUACVFE-WGEHSIRBSA-N.
| Molecular formula | C12H20O6 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | (3S,9S)-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-2,8-diol |
| InChIKey | LDPFQVWIUACVFE-WGEHSIRBSA-N |
| SMILES | CC1(O[C@H]2C(C3[C@H](C(C2O1)O)OC(O3)(C)C)O)C |
Computed by PubChem (NCBI)