Products 98985-76-3
CAS 98985-76-3 appears in our catalog under these names: Piliformic Acid, Piliformic acid. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 500μg, 5mg, 25mg, 10mg, 50mg, Get quote.
(2E)-2-hexylidene-3-methylbutanedioic acid (CAS 98985-76-3) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: (2E)-2-hexylidene-3-methylbutanedioic acid. InChIKey: YTUQECDNJQCQAE-VQHVLOKHSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | (2E)-2-hexylidene-3-methylbutanedioic acid |
| InChIKey | YTUQECDNJQCQAE-VQHVLOKHSA-N |
| SMILES | CCCCC/C=C(\C(C)C(=O)O)/C(=O)O |
Computed by PubChem (NCBI)