CAS 99-52-5 appears in our catalog under these names: 2-Methyl-4-nitroaniline, 99%, 2-Amino-5-nitrotoluene, 2-Methyl-4-nitroaniline, 98%, 2-Methyl-4-nitroaniline, >95% (GC), 2-Methyl-4-nitroaniline, >98.0%(GC). Offered by: Thermo Scientific (Acros), Dr. Ehrenstorfer, Combi-blocks, TRC, TCI. Available pack sizes: 5g, 250mg, 100g, 25g, 500g, 250g, 50g, 300g.
2-methyl-4-nitroaniline (CAS 99-52-5) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2-methyl-4-nitroaniline. InChIKey: XTTIQGSLJBWVIV-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2-methyl-4-nitroaniline |
| InChIKey | XTTIQGSLJBWVIV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)