CAS 99076-56-9 appears in our catalog under these names: Tos-Ala-OH, Tos–Ala–OH. Offered by: Creative Peptides, GLPBio. Available pack sizes: 25g, 100g.
(2S)-2-(benzylsulfonylamino)propanoic acid (CAS 99076-56-9) is a chemical compound with the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. IUPAC name: (2S)-2-(benzylsulfonylamino)propanoic acid. InChIKey: CZIBABWRWDOXIT-QMMMGPOBSA-N.
| Molecular formula | C10H13NO4S |
|---|---|
| Molecular weight | 243.28 g/mol |
| IUPAC name | (2S)-2-(benzylsulfonylamino)propanoic acid |
| InChIKey | CZIBABWRWDOXIT-QMMMGPOBSA-N |
| SMILES | C[C@@H](C(=O)O)NS(=O)(=O)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)