CAS 99430-79-2 is the registry number for 1-Phenyl-1-(2-pyridyl)ethanol-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
1-(2,3,4,5,6-pentadeuteriophenyl)-1-pyridin-2-ylethanol (CAS 99430-79-2) is a chemical compound with the molecular formula C13H13NO and a molecular weight of 204.28 g/mol. IUPAC name: 1-(2,3,4,5,6-pentadeuteriophenyl)-1-pyridin-2-ylethanol. InChIKey: JZSWVCNVNOZMFN-ATTUOBAHSA-N.
| Molecular formula | C13H13NO |
|---|---|
| Molecular weight | 204.28 g/mol |
| IUPAC name | 1-(2,3,4,5,6-pentadeuteriophenyl)-1-pyridin-2-ylethanol |
| InChIKey | JZSWVCNVNOZMFN-ATTUOBAHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C)(C2=CC=CC=N2)O)[2H])[2H] |
Computed by PubChem (NCBI)