CAS 99631-79-5 appears in our catalog under these names: Naphthalen-2-yl-L-leucine, 98%, N-2-Naphthalenyl-L-leucine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5g.
(2S)-4-methyl-2-(naphthalen-2-ylamino)pentanoic acid (CAS 99631-79-5) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. IUPAC name: (2S)-4-methyl-2-(naphthalen-2-ylamino)pentanoic acid. InChIKey: XFQFSRJCABMTBA-HNNXBMFYSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | (2S)-4-methyl-2-(naphthalen-2-ylamino)pentanoic acid |
| InChIKey | XFQFSRJCABMTBA-HNNXBMFYSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC1=CC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)