CAS 99891-77-7 is the registry number for Isoboonein acetate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(4aR,6S,7R,7aS)-7-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-6-yl] acetate (CAS 99891-77-7) is a chemical compound with the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. IUPAC name: [(4aR,6S,7R,7aS)-7-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-6-yl] acetate. InChIKey: MBJHSEZGXPVNLN-QQRDMOCMSA-N.
| Molecular formula | C11H16O4 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | [(4aR,6S,7R,7aS)-7-methyl-3-oxo-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-6-yl] acetate |
| InChIKey | MBJHSEZGXPVNLN-QQRDMOCMSA-N |
| SMILES | C[C@H]1[C@H](C[C@H]2[C@@H]1COC(=O)C2)OC(=O)C |
Computed by PubChem (NCBI)