cas: 212270-85-4 — see every product listed under this CAS number, including other names
rel-(1R,3S)-3-(Phenylmethoxy)cyclopentanol, 97%, 97% (CAS 212270-85-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILA2-100mg |
| cas | 212270-85-4 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 525.20 Pln | |
| Chemat | 250mg | 803.60 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1917.20 Pln | |
| Chemat | 5g | 6558.80 Pln | |
| Chemat | 10g | 12131.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Cis-(1S,3R)-3-phenylmethoxycyclopentan-1-ol (CAS 212270-85-4) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: cis-(1S,3R)-3-phenylmethoxycyclopentan-1-ol. InChIKey: SFIICXXRMNDRQC-NWDGAFQWSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | cis-(1S,3R)-3-phenylmethoxycyclopentan-1-ol |
| InChIKey | SFIICXXRMNDRQC-NWDGAFQWSA-N |
| SMILES | C1C[C@H](C[C@H]1O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)