cas: 1311254-40-6 — see every product listed under this CAS number, including other names
rel-(3R,4S)-1-Benzyl 3-ethyl 4-((tert-butoxycarbonyl)amino)pyrrolidine-1,3-dicarboxylate, 95% (CAS 1311254-40-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1512873-5g |
| cas | 1311254-40-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 16130.17 Pln | |
| AmBeed | 10g | 26839.12 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-O-benzyl 3-O-ethyl (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,3-dicarboxylate (CAS 1311254-40-6) is a chemical compound with the molecular formula C20H28N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: 1-O-benzyl 3-O-ethyl (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,3-dicarboxylate. InChIKey: HEPWCOHMSQJSLO-HOTGVXAUSA-N.
| Molecular formula | C20H28N2O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 1-O-benzyl 3-O-ethyl (3S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-1,3-dicarboxylate |
| InChIKey | HEPWCOHMSQJSLO-HOTGVXAUSA-N |
| SMILES | CCOC(=O)[C@H]1CN(C[C@@H]1NC(=O)OC(C)(C)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)