cas: 186393-22-6 — see every product listed under this CAS number, including other names
rel-(3R,4S)-tert-Butyl 3,4-dihydroxypyrrolidine-1-carboxylate 98% (CAS 186393-22-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1226090-100mg |
| cas | 186393-22-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1510.69 Pln | |
| Ambeed | 10g | 2089.19 Pln | |
| Ambeed | 25g | 3802.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1226090 |
Tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (CAS 186393-22-6) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate. InChIKey: MAXQBMZDVBHSLW-KNVOCYPGSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| InChIKey | MAXQBMZDVBHSLW-KNVOCYPGSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)O)O |
Computed by PubChem (NCBI)