Products 1820570-23-7
CAS 1820570-23-7 appears in our catalog under these names: Methyl (2s)-2-[(methoxycarbonyl)amino]-3,3-dimethylbutanoate, 95%, MEthyl (2s)-2-((methoxycarbonyl)amino)-3,3-dimethylbutanoate, 95%, Methyl (2s)-2-[(methoxycarbonyl)amino]-3,3-dimethylbutanoate, 98%, 98%, Methyl (S)-2-((methoxycarbonyl)amino)-3,3-dimethylbutanoate, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
Methyl (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate (CAS 1820570-23-7) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: methyl (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate. InChIKey: UEVABOCTUCGAPH-ZCFIWIBFSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | methyl (2S)-2-(methoxycarbonylamino)-3,3-dimethylbutanoate |
| InChIKey | UEVABOCTUCGAPH-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)OC)NC(=O)OC |
Computed by PubChem (NCBI)