cas: 186393-22-6 — see every product listed under this CAS number, including other names
rel-(3R,4S)-tert-Butyl 3,4-dihydroxypyrrolidine-1-carboxylate, 98%, 98% (CAS 186393-22-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AQTZ-25mg |
| cas | 186393-22-6 |
| size | 25mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 98.00 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 246.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1922.00 Pln | |
| Chemat | 50g | 3165.20 Pln | |
| Chemat | 100g | 5958.80 Pln | |
| Chemat | 250g | 11128.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (CAS 186393-22-6) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate. InChIKey: MAXQBMZDVBHSLW-KNVOCYPGSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| InChIKey | MAXQBMZDVBHSLW-KNVOCYPGSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)O)O |
Computed by PubChem (NCBI)