cas: 1251012-40-4 — see every product listed under this CAS number, including other names
rel-tert-Butyl (3aR,4S,6aS)-4-aminohexahydrocyclopenta[c]pyrrole-2(1H)-carboxylate, 97%, 97% (CAS 1251012-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HI2G-100mg |
| cas | 1251012-40-4 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1552.40 Pln | |
| Chemat | 250mg | 2440.40 Pln | |
| Chemat | 500mg | 4024.40 Pln | |
| Chemat | 1g | 6006.80 Pln | |
| Chemat | 5g | 17891.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (CAS 1251012-40-4) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate. InChIKey: VMUXGMBHACBHJJ-UTLUCORTSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (3aR,4S,6aS)-4-amino-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| InChIKey | VMUXGMBHACBHJJ-UTLUCORTSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC[C@@H]([C@H]2C1)N |
Computed by PubChem (NCBI)