cas: 1259278-17-5 — see every product listed under this CAS number, including other names
tert-Butyl ((1R,3S)-3-aminocyclohexyl)carbamate 98% (CAS 1259278-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A363439-100mg |
| cas | 1259278-17-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1744.31 Pln | |
| Ambeed | 25g | 6038.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A363439 |
Tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate (CAS 1259278-17-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate. InChIKey: OBSACSBMTRJNPH-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | OBSACSBMTRJNPH-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)N |
Computed by PubChem (NCBI)