cas: 1259278-17-5 — see every product listed under this CAS number, including other names
tert-Butyl ((1R,3S)-3-aminocyclohexyl)carbamate, 97% (CAS 1259278-17-5) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g, 10g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603012-500MG |
| cas | 1259278-17-5 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 476.93 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1736.91 Pln | |
| Fluorochem | 10g | 3288.44 Pln | |
| Fluorochem | 50g | 16231.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate (CAS 1259278-17-5) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate. InChIKey: OBSACSBMTRJNPH-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl N-[(1R,3S)-3-aminocyclohexyl]carbamate |
| InChIKey | OBSACSBMTRJNPH-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCC[C@@H](C1)N |
Computed by PubChem (NCBI)