cas: 1172623-99-2 — see every product listed under this CAS number, including other names
tert-Butyl ((2R,3S)-2-(2,5-difluorophenyl)-5-hydroxytetrahydro-2H-pyran-3-yl)carbamate 95% (CAS 1172623-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A604202-100mg |
| cas | 1172623-99-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A604202 |
Tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate (CAS 1172623-99-2) is a chemical compound with the molecular formula C16H21F2NO4 and a molecular weight of 329.34 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate. InChIKey: RYDSJJXCDQFTKF-INPHSSGZSA-N.
| Molecular formula | C16H21F2NO4 |
|---|---|
| Molecular weight | 329.34 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate |
| InChIKey | RYDSJJXCDQFTKF-INPHSSGZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(CO[C@@H]1C2=C(C=CC(=C2)F)F)O |
Computed by PubChem (NCBI)