cas: 886851-28-1 — see every product listed under this CAS number, including other names
tert-Butyl ((3-fluoropyridin-2-yl)methyl)carbamate 95+% (CAS 886851-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A686121-1g |
| cas | 886851-28-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A686121 |
Tert-butyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate (CAS 886851-28-1) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate. InChIKey: JKLFDXDBLLWDNO-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-[(3-fluoro-2-pyridinyl)methyl]carbamate |
| InChIKey | JKLFDXDBLLWDNO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=CC=N1)F |
Computed by PubChem (NCBI)