cas: 1203566-77-1 — see every product listed under this CAS number, including other names
tert-Butyl ((3R,4R)-4-hydroxypyrrolidin-3-yl)carbamate, 95% (CAS 1203566-77-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F547861-100MG |
| cas | 1203566-77-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 424.87 Pln | |
| Fluorochem | 250mg | 674.78 Pln | |
| Fluorochem | 1g | 2153.43 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]carbamate (CAS 1203566-77-1) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]carbamate. InChIKey: QAZVTJCOYJOJGO-RNFRBKRXSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]carbamate |
| InChIKey | QAZVTJCOYJOJGO-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@H]1O |
Computed by PubChem (NCBI)