cas: 870632-91-0 — see every product listed under this CAS number, including other names
tert-Butyl ((3S,4S)-4-hydroxypyrrolidin-3-yl)carbamate, 97% (CAS 870632-91-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A998174-1g |
| cas | 870632-91-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 8396.29 Pln | |
| AmBeed | 10g | 28785.61 Pln | |
| AmBeed | 5g | 17301.97 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate (CAS 870632-91-0) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate. InChIKey: QAZVTJCOYJOJGO-BQBZGAKWSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl N-[(3S,4S)-4-hydroxypyrrolidin-3-yl]carbamate |
| InChIKey | QAZVTJCOYJOJGO-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNC[C@@H]1O |
Computed by PubChem (NCBI)