cas: 334016-81-8 — see every product listed under this CAS number, including other names
tert-Butyl ((5-bromo-2-methoxypyridin-3-yl)methyl)carbamate, 98% (CAS 334016-81-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690640-100MG |
| cas | 334016-81-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 768.50 Pln | |
| Fluorochem | 1g | 1971.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]carbamate (CAS 334016-81-8) is a chemical compound with the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. IUPAC name: tert-butyl N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]carbamate. InChIKey: UBJLVGVELDIIMA-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O3 |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | tert-butyl N-[(5-bromo-2-methoxy-3-pyridinyl)methyl]carbamate |
| InChIKey | UBJLVGVELDIIMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(N=CC(=C1)Br)OC |
Computed by PubChem (NCBI)