cas: 1186663-67-1 — see every product listed under this CAS number, including other names
tert-Butyl (1-amino-4-methylpentan-2-yl)carbamate (CAS 1186663-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F446581-250MG |
| cas | 1186663-67-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1153.78 Pln | |
| Fluorochem | 500mg | 1788.97 Pln | |
| Fluorochem | 1g | 2720.93 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl N-(1-amino-4-methylpentan-2-yl)carbamate (CAS 1186663-67-1) is a chemical compound with the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. IUPAC name: tert-butyl N-(1-amino-4-methylpentan-2-yl)carbamate. InChIKey: WUTNGQAKAKFXRM-UHFFFAOYSA-N.
| Molecular formula | C11H24N2O2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | tert-butyl N-(1-amino-4-methylpentan-2-yl)carbamate |
| InChIKey | WUTNGQAKAKFXRM-UHFFFAOYSA-N |
| SMILES | CC(C)CC(CN)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)