cas: 132234-68-5 — see every product listed under this CAS number, including other names
tert-Butyl (1R,3S,5S)-8-azabicyclo[3.2.1]octan-3-ylcarbamate, 97% (CAS 132234-68-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236871-100MG |
| cas | 132234-68-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1705.67 Pln | |
| Fluorochem | 10g | 3361.33 Pln | |
| Fluorochem | 25g | 8068.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate (CAS 132234-68-5) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate. InChIKey: UUHPKKKRSZBQIG-ULKQDVFKSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl N-[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl]carbamate |
| InChIKey | UUHPKKKRSZBQIG-ULKQDVFKSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C[C@H]2CC[C@@H](C1)N2 |
Computed by PubChem (NCBI)