cas: 799279-81-5 — see every product listed under this CAS number, including other names
tert-Butyl (1R,5S)-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate, 98% (CAS 799279-81-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F602464-50MG |
| cas | 799279-81-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 471.73 Pln | |
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1221.46 Pln | |
| Fluorochem | 5g | 7448.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (1R,5S)-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate (CAS 799279-81-5) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl (1R,5S)-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate. InChIKey: YPCQQZHIBTVQAB-HTQZYQBOSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl (1R,5S)-3,6-diazabicyclo[3.2.0]heptane-6-carboxylate |
| InChIKey | YPCQQZHIBTVQAB-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2[C@H]1CNC2 |
Computed by PubChem (NCBI)