cas: 103549-24-2 — see every product listed under this CAS number, including other names
tert-Butyl (2-(1H-indol-3-yl)ethyl)carbamate (CAS 103549-24-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 25g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241618-100MG |
| cas | 103549-24-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 914.28 Pln | |
| Fluorochem | 250mg | 1502.61 Pln | |
| Fluorochem | 5g | 11129.43 Pln | |
| Fluorochem | 25g | 33246.64 Pln | |
| Fluorochem | 1g | 4350.57 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate (CAS 103549-24-2) is a chemical compound with the molecular formula C15H20N2O2 and a molecular weight of 260.33 g/mol. IUPAC name: tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate. InChIKey: UJUWQLXEMKUVGE-UHFFFAOYSA-N.
| Molecular formula | C15H20N2O2 |
|---|---|
| Molecular weight | 260.33 g/mol |
| IUPAC name | tert-butyl N-[2-(1H-indol-3-yl)ethyl]carbamate |
| InChIKey | UJUWQLXEMKUVGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)