cas: 314773-77-8 — see every product listed under this CAS number, including other names
tert-Butyl (2-acetylphenyl)carbamate 98% (CAS 314773-77-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A402316-250mg |
| cas | 314773-77-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 298.06 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1955.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A402316 |
Tert-butyl N-(2-acetylphenyl)carbamate (CAS 314773-77-8) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: tert-butyl N-(2-acetylphenyl)carbamate. InChIKey: GSAPPURHQAMLCE-UHFFFAOYSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | tert-butyl N-(2-acetylphenyl)carbamate |
| InChIKey | GSAPPURHQAMLCE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)