cas: 362670-07-3 — see every product listed under this CAS number, including other names
tert-Butyl (2-amino-5-fluorophenyl)carbamate, 95% (CAS 362670-07-3) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F385508-200MG |
| cas | 362670-07-3 |
| size | 200mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 200mg | 310.33 Pln | |
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 685.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-amino-5-fluorophenyl)carbamate (CAS 362670-07-3) is a chemical compound with the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. IUPAC name: tert-butyl N-(2-amino-5-fluorophenyl)carbamate. InChIKey: FELBQUPQCJZQQX-UHFFFAOYSA-N.
| Molecular formula | C11H15FN2O2 |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | tert-butyl N-(2-amino-5-fluorophenyl)carbamate |
| InChIKey | FELBQUPQCJZQQX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)F)N |
Computed by PubChem (NCBI)