cas: 1240621-19-5 — see every product listed under this CAS number, including other names
tert-Butyl (2-methyloxazol-4-yl)carbamate, 97% (CAS 1240621-19-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F738158-100MG |
| cas | 1240621-19-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 659.16 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 500mg | 1997.23 Pln | |
| Fluorochem | 1g | 2569.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(2-methyl-1,3-oxazol-4-yl)carbamate (CAS 1240621-19-5) is a chemical compound with the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. IUPAC name: tert-butyl N-(2-methyl-1,3-oxazol-4-yl)carbamate. InChIKey: VHCBSNJAXKWWRN-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O3 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | tert-butyl N-(2-methyl-1,3-oxazol-4-yl)carbamate |
| InChIKey | VHCBSNJAXKWWRN-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CO1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)