cas: 1523541-79-8 — see every product listed under this CAS number, including other names
tert-Butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate hydrochloride 98+% (CAS 1523541-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A629703-1g |
| cas | 1523541-79-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 581.75 Pln | |
| Ambeed | 10g | 987.81 Pln | |
| Ambeed | 25g | 1432.81 Pln |
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A629703 |
Tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride (CAS 1523541-79-8) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride. InChIKey: TWALJKZSNHQOBH-OULXEKPRSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | TWALJKZSNHQOBH-OULXEKPRSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)C.Cl |
Computed by PubChem (NCBI)