CAS 1049727-98-1 appears in our catalog under these names: 4-Boc-aminomethyl piperidine hydrochloride, 96%, tert-Butyl (piperidin-4-ylmethyl)carbamate hydrochloride, 95%, tert-Butyl (piperidin-4-ylmethyl)carbamate hydrochloride, 95%, 95%, tert-Butyl (piperidin-4-ylmethyl)carbamate hydrochloride. Offered by: Combi-blocks, AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, Get quote.
Tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride (CAS 1049727-98-1) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride. InChIKey: YAFYUSHKQUUFGI-UHFFFAOYSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride |
| InChIKey | YAFYUSHKQUUFGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCNCC1.Cl |
Computed by PubChem (NCBI)