CAS 1523541-79-8 appears in our catalog under these names: tert-Butyl trans-2,5-dimethylpiperazine-1-carboxylate hydrochloride, 95%, (2R,5S)-1-Boc-2,5-dimethylpiperazine hydrochloride, 95%, tert-Butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate hydrochloride 98+%, tert-Butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate hydrochloride, 98+%, 98+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g.
Tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride (CAS 1523541-79-8) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride. InChIKey: TWALJKZSNHQOBH-OULXEKPRSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (2R,5S)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | TWALJKZSNHQOBH-OULXEKPRSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1C(=O)OC(C)(C)C)C.Cl |
Computed by PubChem (NCBI)