cas: 1107659-77-7 — see every product listed under this CAS number, including other names
tert-Butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate, >95%, >95% (CAS 1107659-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL0M-100mg |
| cas | 1107659-77-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 909.20 Pln | |
| Chemat | 250mg | 1475.60 Pln | |
| Chemat | 1g | 4058.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (CAS 1107659-77-7) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate. InChIKey: RLHMCXQTIPFLRQ-JGVFFNPUSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| InChIKey | RLHMCXQTIPFLRQ-JGVFFNPUSA-N |
| SMILES | C[C@H]1[C@@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)