cas: 1107659-77-7 — see every product listed under this CAS number, including other names
tert-Butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate, 97% (CAS 1107659-77-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 500mg, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A711796-5g |
| cas | 1107659-77-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 22724.80 Pln | |
| Fluorochem | 500mg | 4069.42 Pln | |
| Fluorochem | 100mg | 1299.56 Pln | |
| Fluorochem | 250mg | 2226.32 Pln | |
| Fluorochem | 1g | 7453.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate (CAS 1107659-77-7) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate. InChIKey: RLHMCXQTIPFLRQ-JGVFFNPUSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2S,3R)-3-hydroxy-2-methylpyrrolidine-1-carboxylate |
| InChIKey | RLHMCXQTIPFLRQ-JGVFFNPUSA-N |
| SMILES | C[C@H]1[C@@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)