cas: 1364663-23-9 — see every product listed under this CAS number, including other names
tert-Butyl (3,5-difluoropyridin-4-yl)carbamate, 97% (CAS 1364663-23-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A739595-1g |
| cas | 1364663-23-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 974.89 Pln | |
| AmBeed | 5g | 4418.68 Pln | |
| AmBeed | 100mg | 167.65 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(3,5-difluoro-4-pyridinyl)carbamate (CAS 1364663-23-9) is a chemical compound with the molecular formula C10H12F2N2O2 and a molecular weight of 230.21 g/mol. IUPAC name: tert-butyl N-(3,5-difluoro-4-pyridinyl)carbamate. InChIKey: GNWNEMPHMVGLOJ-UHFFFAOYSA-N.
| Molecular formula | C10H12F2N2O2 |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | tert-butyl N-(3,5-difluoro-4-pyridinyl)carbamate |
| InChIKey | GNWNEMPHMVGLOJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=NC=C1F)F |
Computed by PubChem (NCBI)