cas: 515813-02-2 — see every product listed under this CAS number, including other names
tert-Butyl (3-bromo-4-methylphenyl)carbamate, 98% (CAS 515813-02-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F335843-1G |
| cas | 515813-02-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 372.80 Pln | |
| Fluorochem | 25g | 581.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-(3-bromo-4-methylphenyl)carbamate (CAS 515813-02-2) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: tert-butyl N-(3-bromo-4-methylphenyl)carbamate. InChIKey: DNOLDJLTBWGCQD-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | tert-butyl N-(3-bromo-4-methylphenyl)carbamate |
| InChIKey | DNOLDJLTBWGCQD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)