cas: 641571-03-1 — see every product listed under this CAS number, including other names
tert-Butyl (3-bromo-5-(trifluoromethyl)phenyl)carbamate, 98%, 98% (CAS 641571-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EJ91-100mg |
| cas | 641571-03-1 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 995.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[3-bromo-5-(trifluoromethyl)phenyl]carbamate (CAS 641571-03-1) is a chemical compound with the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. IUPAC name: tert-butyl N-[3-bromo-5-(trifluoromethyl)phenyl]carbamate. InChIKey: PGCWCIPXTAAMTC-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO2 |
|---|---|
| Molecular weight | 340.14 g/mol |
| IUPAC name | tert-butyl N-[3-bromo-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | PGCWCIPXTAAMTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)