cas: 641571-03-1 — see every product listed under this CAS number, including other names
tert-Butyl (3-bromo-5-(trifluoromethyl)phenyl)carbamate, 98% (CAS 641571-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A415759-1g |
| cas | 641571-03-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 577.78 Pln | |
| AmBeed | 25g | 4132.24 Pln | |
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1002.79 Pln | |
| Fluorochem | 25g | 3340.51 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-[3-bromo-5-(trifluoromethyl)phenyl]carbamate (CAS 641571-03-1) is a chemical compound with the molecular formula C12H13BrF3NO2 and a molecular weight of 340.14 g/mol. IUPAC name: tert-butyl N-[3-bromo-5-(trifluoromethyl)phenyl]carbamate. InChIKey: PGCWCIPXTAAMTC-UHFFFAOYSA-N.
| Molecular formula | C12H13BrF3NO2 |
|---|---|
| Molecular weight | 340.14 g/mol |
| IUPAC name | tert-butyl N-[3-bromo-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | PGCWCIPXTAAMTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)