cas: 1234570-45-6 — see every product listed under this CAS number, including other names
tert-Butyl (3-hydroxyphenyl)(methyl)carbamate, 95% (CAS 1234570-45-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A798949-10g |
| cas | 1234570-45-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8194.48 Pln | |
| AmBeed | 250mg | 467.11 Pln | |
| AmBeed | 5g | 5486.32 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(3-hydroxyphenyl)-N-methylcarbamate (CAS 1234570-45-6) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl N-(3-hydroxyphenyl)-N-methylcarbamate. InChIKey: AOEYIWSHRFMESO-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl N-(3-hydroxyphenyl)-N-methylcarbamate |
| InChIKey | AOEYIWSHRFMESO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)