cas: 1675225-21-4 — see every product listed under this CAS number, including other names
tert-Butyl (3R,5R)-3-((tert-butyldimethylsilyl)oxy)-5-hydroxypiperidine-1-carboxylate, 97% (CAS 1675225-21-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1g, 5g, 10g, 25g, 100g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A602079-250mg |
| cas | 1675225-21-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 5564.44 Pln | |
| Fluorochem | 100mg | 305.12 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 648.75 Pln | |
| Fluorochem | 1g | 1039.24 Pln | |
| Chemat | 100mg | 194.00 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 500mg | 395.60 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 1734.80 Pln | |
| Chemat | 10g | 3126.80 Pln | |
| Chemat | 25g | 6189.20 Pln | |
| Chemat | 100g | 18630.80 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl (3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypiperidine-1-carboxylate (CAS 1675225-21-4) is a chemical compound with the molecular formula C16H33NO4Si and a molecular weight of 331.52 g/mol. IUPAC name: tert-butyl (3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypiperidine-1-carboxylate. InChIKey: PUEAOZNPUCMJCE-CHWSQXEVSA-N.
| Molecular formula | C16H33NO4Si |
|---|---|
| Molecular weight | 331.52 g/mol |
| IUPAC name | tert-butyl (3R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxypiperidine-1-carboxylate |
| InChIKey | PUEAOZNPUCMJCE-CHWSQXEVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H](C1)O[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)