cas: 361436-27-3 — see every product listed under this CAS number, including other names
tert-Butyl (4-bromo-3,5-dimethylphenyl)carbamate, 97% (CAS 361436-27-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218693-100MG |
| cas | 361436-27-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 846.59 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl N-(4-bromo-3,5-dimethylphenyl)carbamate (CAS 361436-27-3) is a chemical compound with the molecular formula C13H18BrNO2 and a molecular weight of 300.19 g/mol. IUPAC name: tert-butyl N-(4-bromo-3,5-dimethylphenyl)carbamate. InChIKey: CMNVKVHPODARGJ-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO2 |
|---|---|
| Molecular weight | 300.19 g/mol |
| IUPAC name | tert-butyl N-(4-bromo-3,5-dimethylphenyl)carbamate |
| InChIKey | CMNVKVHPODARGJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1Br)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)