cas: 60144-53-8 — see every product listed under this CAS number, including other names
tert-Butyl (4-fluorophenyl)carbamate 98% (CAS 60144-53-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A494381-1g |
| cas | 60144-53-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 25g | 320.31 Pln | |
| Ambeed | 100g | 926.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A494381 |
Tert-butyl N-(4-fluorophenyl)carbamate (CAS 60144-53-8) is a chemical compound with the molecular formula C11H14FNO2 and a molecular weight of 211.23 g/mol. IUPAC name: tert-butyl N-(4-fluorophenyl)carbamate. InChIKey: OJVWNENFSPSLRB-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO2 |
|---|---|
| Molecular weight | 211.23 g/mol |
| IUPAC name | tert-butyl N-(4-fluorophenyl)carbamate |
| InChIKey | OJVWNENFSPSLRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)F |
Computed by PubChem (NCBI)