cas: 380629-73-2 — see every product listed under this CAS number, including other names
tert-Butyl (5-aminobenzo[d]isoxazol-3-yl)carbamate, 95%, 95% (CAS 380629-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLDW-100mg |
| cas | 380629-73-2 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1264.40 Pln | |
| Chemat | 5g | 3899.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-amino-1,2-benzoxazol-3-yl)carbamate (CAS 380629-73-2) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. IUPAC name: tert-butyl N-(5-amino-1,2-benzoxazol-3-yl)carbamate. InChIKey: VKHZQNDFOLJRBM-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | tert-butyl N-(5-amino-1,2-benzoxazol-3-yl)carbamate |
| InChIKey | VKHZQNDFOLJRBM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NOC2=C1C=C(C=C2)N |
Computed by PubChem (NCBI)