cas: 1138443-96-5 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromo-3-methoxypyridin-2-yl)-methylcarbamate (CAS 1138443-96-5) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1110UP-1g |
| cas | 1138443-96-5 |
| size | 1g |
| availability | 1.37g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 11325.20 Pln |
| delivery time | 3 weeks |
|---|
Tert-butyl N-[(5-bromo-3-methoxy-2-pyridinyl)methyl]carbamate (CAS 1138443-96-5) is a chemical compound with the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. IUPAC name: tert-butyl N-[(5-bromo-3-methoxy-2-pyridinyl)methyl]carbamate. InChIKey: FTBWBVPCPVJBGF-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O3 |
|---|---|
| Molecular weight | 317.18 g/mol |
| IUPAC name | tert-butyl N-[(5-bromo-3-methoxy-2-pyridinyl)methyl]carbamate |
| InChIKey | FTBWBVPCPVJBGF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=C(C=C(C=N1)Br)OC |
Computed by PubChem (NCBI)