cas: 2246366-90-3 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromo-4-ethylpyridin-3-yl)carbamate, 95%, 95% (CAS 2246366-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1EXL51-100mg |
| cas | 2246366-90-3 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| Chemat | 10g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(5-bromo-4-ethyl-3-pyridinyl)carbamate (CAS 2246366-90-3) is a chemical compound with the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. IUPAC name: tert-butyl N-(5-bromo-4-ethyl-3-pyridinyl)carbamate. InChIKey: SJTPRLPGJXSJRM-UHFFFAOYSA-N.
| Molecular formula | C12H17BrN2O2 |
|---|---|
| Molecular weight | 301.18 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-4-ethyl-3-pyridinyl)carbamate |
| InChIKey | SJTPRLPGJXSJRM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=NC=C1NC(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)