cas: 401811-77-6 — see every product listed under this CAS number, including other names
tert-Butyl (5-bromobenzo[d][1,3]dioxol-4-yl)carbamate 95% (CAS 401811-77-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117968-100mg |
| cas | 401811-77-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 3324.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117968 |
Tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate (CAS 401811-77-6) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate. InChIKey: JMDLHOQJZIIQMX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate |
| InChIKey | JMDLHOQJZIIQMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC2=C1OCO2)Br |
Computed by PubChem (NCBI)