CAS 401811-77-6 appears in our catalog under these names: tert-Butyl (5-bromobenzo[d][1,3]dioxol-4-yl)carbamate, 95%, tert–Butyl (5–bromobenzo(d)(1,3)dioxol–4–yl)carbamate, tert-Butyl (5-bromobenzo[d][1,3]dioxol-4-yl)carbamate, 95%, 95%, tert-Butyl (5-bromobenzo[d][1,3]dioxol-4-yl)carbamate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
Tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate (CAS 401811-77-6) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate. InChIKey: JMDLHOQJZIIQMX-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-1,3-benzodioxol-4-yl)carbamate |
| InChIKey | JMDLHOQJZIIQMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC2=C1OCO2)Br |
Computed by PubChem (NCBI)